Molecular Definition

Canonical SMILES CO[C@@H]1CC[C@@H](CC1)C(=O)Nc2nc(C)c(s2)c3ccc(N)nc3
Formula C17H22N4O2S
Molecular Weight 346.45 da
Stereocenters 2/2