Molecular Definition

Canonical SMILES COc1ccc(CNC(=O)Nc2ccc(cc2)S(=O)(=O)c3ccccc3)cn1
Formula C20H19N3O4S
Molecular Weight 397.45 da
Stereocenters 0/0