Molecular Definition

Canonical SMILES C(N1CCC(CC1)n2nnc3cnc4[nH]ccc4c23)c5cccnc5
Formula C18H19N7
Molecular Weight 333.39 da
Stereocenters 0/0