Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cn1)C(=O)Nc2cc(Br)cc3C(=O)C=C(Oc23)C(=O)O
Formula C17H11BrN2O6
Molecular Weight 419.18 da
Stereocenters 0/0