Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1)C(=O)Nc2cc(Cl)cc3C(=O)C=C(Oc23)C(=O)O
Formula C18H12ClNO6
Molecular Weight 373.74 da
Stereocenters 0/0