Molecular Definition

Canonical SMILES Fc1cccc(CNC(=O)Nc2ccc(cc2)S(=O)(=O)N3CCCCC3)c1
Formula C19H22FN3O3S
Molecular Weight 391.46 da
Stereocenters 0/0