Molecular Definition

Canonical SMILES CC(NC(=O)Nc1ccc(cc1)S(=O)(=O)c2ccccc2)c3cccnc3
Formula C20H19N3O3S
Molecular Weight 381.45 da
Stereocenters 0/1