Molecular Definition

Canonical SMILES CCCc1c(O)c(ccc1OCCCSc2ccc(CC(=O)O)cc2Cl)\C(=N\O)\CC
Formula C23H28ClNO5S
Molecular Weight 465.99 da
Stereocenters 0/0