Target Relevance

Molecular Definition

Canonical SMILES NCCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c2ccc3ccccc3c2)C(=O)N
Formula C26H30N4O3
Molecular Weight 446.54 da
Stereocenters 2/2