Target Relevance

Molecular Definition

Canonical SMILES CC(C)(C)c1ccc(cc1)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CCCCN)C(=O)N
Formula C26H36N4O3
Molecular Weight 452.59 da
Stereocenters 2/2