Molecular Definition

Canonical SMILES C[C@@H](NC(=O)c1c[nH]c2ncc(nc12)c3nn(C)c4ccc(Cl)cc34)C(=O)N5CC(C5)C#N
Formula C22H19ClN8O2
Molecular Weight 462.89 da
Stereocenters 1/1