Molecular Definition

Canonical SMILES CN([C@H]1CCCC[C@H]1N2CCCC2)S(=O)(=O)c3ccccc3
Formula C17H26N2O2S
Molecular Weight 322.47 da
Stereocenters 2/2