Molecular Definition

Canonical SMILES CCCc1cc2N(Cc3ccccc3)C(=O)C4(NN=C(S4)c5ccc(OC)cc5)c2cc1C
Formula C27H27N3O2S
Molecular Weight 457.59 da
Stereocenters 0/1