Target Relevance

Molecular Definition

Canonical SMILES CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)Nc2ccccc2C(=O)NC(C(=O)O)C(=O)CF
Formula C24H26FN3O7
Molecular Weight 487.48 da
Stereocenters 1/2