Molecular Definition

Canonical SMILES CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CCC(=O)N)NC(=O)CCCCCNC(=O)[C@H](CS)NC(=O)CNC(=O)CN)C(C)C)C(=O)N
Formula C56H87N17O13S2
Molecular Weight 1270.53 da
Stereocenters 8/8