Molecular Definition

Canonical SMILES CN(C)[C@@H]1C[C@H](C1)c2c[nH]c3ccc(CC4COC(=O)N4C)cc23
Formula C19H25N3O2
Molecular Weight 327.42 da
Stereocenters 2/3