Molecular Definition

Canonical SMILES OC(=O)Cc1cc(Cl)c(Oc2ccc(O)c(c2)c3cccc(OC(F)(F)F)c3)c(Cl)c1
Formula C21H13Cl2F3O5
Molecular Weight 473.23 da
Stereocenters 0/0