Molecular Definition

Canonical SMILES COc1ccc(OCCN2CCC3CCCC(N3S(=O)(=O)c4cc(Cl)c(O)c(Cl)c4)C2=O)cc1OC
Formula C24H28Cl2N2O7S
Molecular Weight 559.46 da
Stereocenters 0/2