Molecular Definition

Canonical SMILES CN1[C@@H]([C@@H](O[C@@H](Cc2ccccc2)C1=O)c3ccc(Br)cc3)c4ccc(Br)cc4
Formula C24H21Br2NO2
Molecular Weight 515.24 da
Stereocenters 3/3