Target Relevance

Molecular Definition

Canonical SMILES COc1cccc2O[C@@H](C3=C(N(C)c4ncnn4[C@H]3c5ccc(Br)cc5)c12)c6ccc(Br)cc6
Formula C26H20Br2N4O2
Molecular Weight 580.27 da
Stereocenters 2/2