Target Relevance

Molecular Definition

Canonical SMILES CC(CNC(=O)c1ncoc1Cc2ccc(cc2)c3cccc(NC(=O)C)c3)c4ccccc4
Formula C28H27N3O3
Molecular Weight 453.53 da
Stereocenters 0/1