Target Relevance

Molecular Definition

Canonical SMILES OC[C@H]1O[C@@H](Oc2cc(O)c3C(=O)C=C(Oc3c2)c4ccc(O)c(O)c4)[C@H](O)[C@@H](O)[C@@H]1O
Formula C21H20O11
Molecular Weight 448.38 da
Stereocenters 5/5