Molecular Definition

Canonical SMILES CCN(CC)Cc1ccc(cc1)C(=O)N(CCc2ccccc2OC)[C@@H]3CCNC3
Formula C25H35N3O2
Molecular Weight 409.56 da
Stereocenters 1/1