Target Relevance

Molecular Definition

Canonical SMILES C\C(=N/OCc1ccc(c2ccc(C)cc2)c(c1)C(F)(F)F)\c3ccc(CNCCC(=O)O)cc3
Formula C27H27F3N2O3
Molecular Weight 484.51 da
Stereocenters 0/0