Target Relevance

Molecular Definition

Canonical SMILES COc1cc2CCN3CC[C@](O)(C[C@@H]3c2cc1O)c4ccc(Cl)cc4
Formula C20H22ClNO3
Molecular Weight 359.85 da
Stereocenters 2/2