Molecular Definition

Canonical SMILES CCN(CC)Cc1ccc(cc1)C(=O)N(CCc2ccccc2Cl)C3CCNC3
Formula C24H32ClN3O
Molecular Weight 413.98 da
Stereocenters 0/1