Target Relevance

Molecular Definition

Canonical SMILES C[C@@H](NC(=O)c1cccnc1)C(=O)N2CCC[C@H]2B(O)O
Formula C13H18BN3O4
Molecular Weight 291.11 da
Stereocenters 2/2