Molecular Definition

Canonical SMILES Clc1cccc(CCN(C2CCNC2)C(=O)c3ccc(OCc4ccccc4)cc3)c1
Formula C26H27ClN2O2
Molecular Weight 434.96 da
Stereocenters 0/1