Molecular Definition

Canonical SMILES CCOC(=O)c1ccc(cc1)c2csc3C(=O)C=C(Oc23)N4CCOCC4
Formula C20H19NO5S
Molecular Weight 385.43 da
Stereocenters 0/0