Target Relevance

Molecular Definition

Canonical SMILES COC(=O)c1cn(nn1)c2ccc3OS(=O)(=O)C=Cc3c2
Formula C12H9N3O5S
Molecular Weight 307.28 da
Stereocenters 0/0