Molecular Definition

Canonical SMILES CCc1nsc(NS(=O)(=O)c2ccc(Oc3ccccc3c4ccccc4)c(c2)C#N)n1
Formula C23H18N4O3S2
Molecular Weight 462.54 da
Stereocenters 0/0