Molecular Definition

Canonical SMILES COc1nccnc1NS(=O)(=O)c2ccc(Oc3ccc(Cl)cc3c4ccnn4C)c(c2)C#N
Formula C22H17ClN6O4S
Molecular Weight 496.93 da
Stereocenters 0/0