Molecular Definition

Canonical SMILES Cc1cc(sn1)c2ccccc2Oc3ccc(cc3C#N)S(=O)(=O)Nc4ccc(F)cn4
Formula C22H15FN4O3S2
Molecular Weight 466.51 da
Stereocenters 0/0