Molecular Definition

Canonical SMILES FC(F)(F)c1cc(CNC(=O)c2ccc(cc2)S(=O)(=O)Nc3ncc(Cl)s3)ccc1Cl
Formula C18H12Cl2F3N3O3S2
Molecular Weight 510.34 da
Stereocenters 0/0