Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)\C=C\[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)OCc1ccccc1)c2ccccc2)C(C)C
Formula C33H40N4O11
Molecular Weight 668.69 da
Stereocenters 4/4