Target Relevance

Molecular Definition

Canonical SMILES CC[C@H](C)[C@H](NC(=O)[C@H](CCC(=O)N)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C)C(=O)N[C@@H](CC(=O)O)\C=C\S(=O)(=O)C
Formula C30H45N5O10S
Molecular Weight 667.77 da
Stereocenters 5/5