Molecular Definition

Canonical SMILES CC(C)c1[nH]nc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1Cc3ccc(NS(=O)(=O)C)cc3
Formula C20H29N3O8S
Molecular Weight 471.53 da
Stereocenters 5/5