Target Relevance

Molecular Definition

Canonical SMILES CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)NC(CC(=O)O)C(=O)CF
Formula C18H23FN2O6
Molecular Weight 382.38 da
Stereocenters 1/2