Target Relevance

Molecular Definition

Canonical SMILES Cc1cccc(c1)c2oc(C(=O)N=C(N)N)c(N)c2
Formula C13H14N4O2
Molecular Weight 258.28 da
Stereocenters 0/0