Molecular Definition

Canonical SMILES COc1ccc(NC(=O)c2ccnc3ccccc23)c(n1)C(=O)NCC4CCC4
Formula C22H22N4O3
Molecular Weight 390.44 da
Stereocenters 0/0