Molecular Definition

Canonical SMILES O[C@@]1(CC[C@H](CC1)N2CC(C2)NC(=O)CNc3cc(nc4ccc(cc34)C(F)(F)F)C#N)c5cncs5
Formula C25H25F3N6O2S
Molecular Weight 530.57 da
Stereocenters 2/2