Molecular Definition

Canonical SMILES O[C@@]1(CC[C@H](CC1)N2CC(C2)NC(=O)CNc3ncnc4ccc(cc34)C(F)(F)F)c5ccccc5
Formula C26H28F3N5O2
Molecular Weight 499.53 da
Stereocenters 2/2