Molecular Definition

Canonical SMILES FC(F)(F)c1ccc2ncnc(NCC(=O)NC3CN(C3)[C@@H]4CC[C@@H](CC4)c5ccccc5)c2c1
Formula C26H28F3N5O
Molecular Weight 483.53 da
Stereocenters 2/2