Molecular Definition

Canonical SMILES CCCCCCCCOc1ccc(NC(=O)[C@@](C)(N)CC(=O)O)cc1C(F)(F)F
Formula C20H29F3N2O4
Molecular Weight 418.45 da
Stereocenters 1/1