Molecular Definition

Canonical SMILES CCCCCCCCOc1ccc(NC(=O)[C@@H](N)CCC(=O)O)cc1
Formula C19H30N2O4
Molecular Weight 350.45 da
Stereocenters 1/1