Molecular Definition

Canonical SMILES CC(C)c1ccccc1c2ccc(O[C@H](Cc3ccccc3)C(=O)O)cc2
Formula C24H24O3
Molecular Weight 360.45 da
Stereocenters 1/1