Molecular Definition

Canonical SMILES CN(C)C1CCC(CC1)Nc2nc(Nc3cc(Cl)cc(Cl)c3)ncc2c4onc(C)c4
Formula C22H26Cl2N6O
Molecular Weight 461.39 da
Stereocenters 0/0