Molecular Definition

Canonical SMILES Cc1ccc(cc1C)C(=O)NOCCCCCC(=O)NO
Formula C15H22N2O4
Molecular Weight 294.35 da
Stereocenters 0/0