Molecular Definition

Canonical SMILES FC(F)(F)c1cccc(c1)N2CCN(CCc3ccc4NC(=O)C(=O)Nc4c3)CC2
Formula C21H21F3N4O2
Molecular Weight 418.41 da
Stereocenters 0/0