Target Relevance

Molecular Definition

Canonical SMILES [O-][N+](=O)c1cccc2c1CCCc3c(nn(c23)c4ccc(Cl)cc4Cl)C(=O)NN5CCCCC5
Formula C24H23Cl2N5O3
Molecular Weight 500.38 da
Stereocenters 0/0